About 3,5-dioxatricyclo[5.2.1.04,8]decan-10-one
3,5-dioxatricyclo[5.2.1.04,8]decan-10-one (PubChem CID 118520873) has the molecular formula C8H10O3
and a molecular weight of 154.16 g/mol. Its IUPAC name is 3,5-dioxatricyclo[5.2.1.04,8]decan-10-one.
Molecular Properties
| Compound Name | 3,5-dioxatricyclo[5.2.1.04,8]decan-10-one |
| PubChem CID | 118520873 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 3,5-dioxatricyclo[5.2.1.04,8]decan-10-one |
| SMILES | O=C1C2COC3OCC1C3C2 |
| InChI | InChI=1S/C8H10O3/c9-7-4-1-5-6(7)3-11-8(5)10-2-4/h4-6,8H,1-3H2 |
| InChIKey | IPUDYIWURNLLIV-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,5-dioxatricyclo[5.2.1.04,8]decan-10-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dioxatricyclo[5.2.1.04,8]decan-10-one?
The IUPAC name of 3,5-dioxatricyclo[5.2.1.04,8]decan-10-one (CID 118520873) is 3,5-dioxatricyclo[5.2.1.04,8]decan-10-one.
What is the SMILES notation for 3,5-dioxatricyclo[5.2.1.04,8]decan-10-one?
The canonical SMILES for 3,5-dioxatricyclo[5.2.1.04,8]decan-10-one is O=C1C2COC3OCC1C3C2.
What is the InChIKey of 3,5-dioxatricyclo[5.2.1.04,8]decan-10-one?
The InChIKey is IPUDYIWURNLLIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O3/c9-7-4-1-5-6(7)3-11-8(5)10-2-4/h4-6,8H,1-3H2.
What are the key properties of 3,5-dioxatricyclo[5.2.1.04,8]decan-10-one?
3,5-dioxatricyclo[5.2.1.04,8]decan-10-one has a molecular weight of 154.16 g/mol, XLogP of 0.19, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dioxatricyclo[5.2.1.04,8]decan-10-one is sourced from PubChem (CID 118520873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).