About 4,6-bis(3,5-dipyridin-4-ylphenyl)-2-fluoropyrimidine
4,6-bis(3,5-dipyridin-4-ylphenyl)-2-fluoropyrimidine (PubChem CID 118521281) has the molecular formula C36H23FN6
and a molecular weight of 558.62 g/mol. Its IUPAC name is 4,6-bis(3,5-dipyridin-4-ylphenyl)-2-fluoropyrimidine.
Molecular Properties
| Compound Name | 4,6-bis(3,5-dipyridin-4-ylphenyl)-2-fluoropyrimidine |
| PubChem CID | 118521281 |
| Molecular Formula | C36H23FN6 |
| Molecular Weight | 558.62 g/mol |
| Exact Mass | 558.20 |
| IUPAC Name | 4,6-bis(3,5-dipyridin-4-ylphenyl)-2-fluoropyrimidine |
| SMILES | Fc1nc(-c2cc(-c3ccncc3)cc(-c3ccncc3)c2)cc(-c2cc(-c3ccncc3)cc(-c3ccncc3)c2)n1 |
| InChI | InChI=1S/C36H23FN6/c37-36-42-34(32-19-28(24-1-9-38-10-2-24)17-29(20-32)25-3-11-39-12-4-25)23-35(43-36)33-21-30(26-5-13-40-14-6-26)18-31(22-33)27-7-15-41-16-8-27/h1-23H |
| InChIKey | FXLGSNAJDBPSGC-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 558.62 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4,6-bis(3,5-dipyridin-4-ylphenyl)-2-fluoropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-bis(3,5-dipyridin-4-ylphenyl)-2-fluoropyrimidine?
The IUPAC name of 4,6-bis(3,5-dipyridin-4-ylphenyl)-2-fluoropyrimidine (CID 118521281) is 4,6-bis(3,5-dipyridin-4-ylphenyl)-2-fluoropyrimidine.
What is the SMILES notation for 4,6-bis(3,5-dipyridin-4-ylphenyl)-2-fluoropyrimidine?
The canonical SMILES for 4,6-bis(3,5-dipyridin-4-ylphenyl)-2-fluoropyrimidine is Fc1nc(-c2cc(-c3ccncc3)cc(-c3ccncc3)c2)cc(-c2cc(-c3ccncc3)cc(-c3ccncc3)c2)n1.
What is the InChIKey of 4,6-bis(3,5-dipyridin-4-ylphenyl)-2-fluoropyrimidine?
The InChIKey is FXLGSNAJDBPSGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H23FN6/c37-36-42-34(32-19-28(24-1-9-38-10-2-24)17-29(20-32)25-3-11-39-12-4-25)23-35(43-36)33-21-30(26-5-13-40-14-6-26)18-31(22-33)27-7-15-41-16-8-27/h1-23H.
What are the key properties of 4,6-bis(3,5-dipyridin-4-ylphenyl)-2-fluoropyrimidine?
4,6-bis(3,5-dipyridin-4-ylphenyl)-2-fluoropyrimidine has a molecular weight of 558.62 g/mol, XLogP of 8.20, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-bis(3,5-dipyridin-4-ylphenyl)-2-fluoropyrimidine is sourced from PubChem (CID 118521281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).