C34H12F8N6O4 — CID 118521292
2-[4-[4-[4,6-bis(furan-2-yl)-1,3,5-triazin-2-yl]-2,3,5,6-tetrafluorophenyl]-2,3,5,6-tetrafluorophenyl]-4,6-bis(furan-2-yl)-1,3,5-triazine (PubChem CID 118521292) has the molecular formula C34H12F8N6O4 and a molecular weight of 720.49 g/mol. Its IUPAC name is 2-[4-[4-[4,6-bis(furan-2-yl)-1,3,5-triazin-2-yl]-2,3,5,6-tetrafluorophenyl]-2,3,5,6-tetrafluorophenyl]-4,6-bis(furan-2-yl)-1,3,5-triazine.
| Compound Name | 2-[4-[4-[4,6-bis(furan-2-yl)-1,3,5-triazin-2-yl]-2,3,5,6-tetrafluorophenyl]-2,3,5,6-tetrafluorophenyl]-4,6-bis(furan-2-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 118521292 |
| Molecular Formula | C34H12F8N6O4 |
| Molecular Weight | 720.49 g/mol |
| Exact Mass | 720.08 |
| IUPAC Name | 2-[4-[4-[4,6-bis(furan-2-yl)-1,3,5-triazin-2-yl]-2,3,5,6-tetrafluorophenyl]-2,3,5,6-tetrafluorophenyl]-4,6-bis(furan-2-yl)-1,3,5-triazine |
| SMILES | Fc1c(F)c(-c2c(F)c(F)c(-c3nc(-c4ccco4)nc(-c4ccco4)n3)c(F)c2F)c(F)c(F)c1-c1nc(-c2ccco2)nc(-c2ccco2)n1 |
| InChI | InChI=1S/C34H12F8N6O4/c35-21-17(22(36)26(40)19(25(21)39)33-45-29(13-5-1-9-49-13)43-30(46-33)14-6-2-10-50-14)18-23(37)27(41)20(28(42)24(18)38)34-47-31(15-7-3-11-51-15)44-32(48-34)16-8-4-12-52-16/h1-12H |
| InChIKey | AMQSQJKGISEMHT-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 129.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.49 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|