C42H8F20N6 — CID 118521294
2-[4-[4-[4,6-bis(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]-4,6-bis(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazine (PubChem CID 118521294) has the molecular formula C42H8F20N6 and a molecular weight of 976.53 g/mol. Its IUPAC name is 2-[4-[4-[4,6-bis(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]-4,6-bis(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazine.
| Compound Name | 2-[4-[4-[4,6-bis(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]-4,6-bis(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 118521294 |
| Molecular Formula | C42H8F20N6 |
| Molecular Weight | 976.53 g/mol |
| Exact Mass | 976.05 |
| IUPAC Name | 2-[4-[4-[4,6-bis(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]-4,6-bis(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazine |
| SMILES | Fc1c(F)c(F)c(-c2nc(-c3ccc(-c4ccc(-c5nc(-c6c(F)c(F)c(F)c(F)c6F)nc(-c6c(F)c(F)c(F)c(F)c6F)n5)cc4)cc3)nc(-c3c(F)c(F)c(F)c(F)c3F)n2)c(F)c1F |
| InChI | InChI=1S/C42H8F20N6/c43-17-13(18(44)26(52)33(59)25(17)51)39-63-37(64-40(67-39)14-19(45)27(53)34(60)28(54)20(14)46)11-5-1-9(2-6-11)10-3-7-12(8-4-10)38-65-41(15-21(47)29(55)35(61)30(56)22(15)48)68-42(66-38)16-23(49)31(57)36(62)32(58)24(16)50/h1-8H |
| InChIKey | QCNBBGGCLIZFAS-UHFFFAOYSA-N |
| XLogP | 12.51 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 976.53 |
| LogP ≤ 5 | 12.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|