C42H24F4N6 — CID 118521305
2-[4-[4-[4,6-bis(4-fluorophenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]-4,6-bis(4-fluorophenyl)-1,3,5-triazine (PubChem CID 118521305) has the molecular formula C42H24F4N6 and a molecular weight of 688.69 g/mol. Its IUPAC name is 2-[4-[4-[4,6-bis(4-fluorophenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]-4,6-bis(4-fluorophenyl)-1,3,5-triazine.
| Compound Name | 2-[4-[4-[4,6-bis(4-fluorophenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]-4,6-bis(4-fluorophenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 118521305 |
| Molecular Formula | C42H24F4N6 |
| Molecular Weight | 688.69 g/mol |
| Exact Mass | 688.20 |
| IUPAC Name | 2-[4-[4-[4,6-bis(4-fluorophenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]-4,6-bis(4-fluorophenyl)-1,3,5-triazine |
| SMILES | Fc1ccc(-c2nc(-c3ccc(F)cc3)nc(-c3ccc(-c4ccc(-c5nc(-c6ccc(F)cc6)nc(-c6ccc(F)cc6)n5)cc4)cc3)n2)cc1 |
| InChI | InChI=1S/C42H24F4N6/c43-33-17-9-29(10-18-33)39-47-37(48-40(51-39)30-11-19-34(44)20-12-30)27-5-1-25(2-6-27)26-3-7-28(8-4-26)38-49-41(31-13-21-35(45)22-14-31)52-42(50-38)32-15-23-36(46)24-16-32/h1-24H |
| InChIKey | OPMBQGJYQMQMPH-UHFFFAOYSA-N |
| XLogP | 10.28 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.69 |
| LogP ≤ 5 | 10.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |