C23H27N3O3S — CID 118521609
N-[(3R)-1-[(4-propan-2-yloxyphenyl)methyl]pyrrolidin-3-yl]quinoline-3-sulfonamide (PubChem CID 118521609) has the molecular formula C23H27N3O3S and a molecular weight of 425.55 g/mol. Its IUPAC name is N-[(3R)-1-[(4-propan-2-yloxyphenyl)methyl]pyrrolidin-3-yl]quinoline-3-sulfonamide.
| Compound Name | N-[(3R)-1-[(4-propan-2-yloxyphenyl)methyl]pyrrolidin-3-yl]quinoline-3-sulfonamide |
|---|---|
| PubChem CID | 118521609 |
| Molecular Formula | C23H27N3O3S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | N-[(3R)-1-[(4-propan-2-yloxyphenyl)methyl]pyrrolidin-3-yl]quinoline-3-sulfonamide |
| SMILES | CC(C)Oc1ccc(CN2CC[C@@H](NS(=O)(=O)c3cnc4ccccc4c3)C2)cc1 |
| InChI | InChI=1S/C23H27N3O3S/c1-17(2)29-21-9-7-18(8-10-21)15-26-12-11-20(16-26)25-30(27,28)22-13-19-5-3-4-6-23(19)24-14-22/h3-10,13-14,17,20,25H,11-12,15-16H2,1-2H3/t20-/m1/s1 |
| InChIKey | MSOCUDDOHRVBMC-HXUWFJFHSA-N |
| XLogP | 3.57 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |