C20H23N3O3 — CID 118521870
1-[[3-[(2-pyridin-2-ylacetyl)amino]phenyl]methyl]piperidine-4-carboxylic acid (PubChem CID 118521870) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is 1-[[3-[(2-pyridin-2-ylacetyl)amino]phenyl]methyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[[3-[(2-pyridin-2-ylacetyl)amino]phenyl]methyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 118521870 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 1-[[3-[(2-pyridin-2-ylacetyl)amino]phenyl]methyl]piperidine-4-carboxylic acid |
| SMILES | O=C(Cc1ccccn1)Nc1cccc(CN2CCC(C(=O)O)CC2)c1 |
| InChI | InChI=1S/C20H23N3O3/c24-19(13-17-5-1-2-9-21-17)22-18-6-3-4-15(12-18)14-23-10-7-16(8-11-23)20(25)26/h1-6,9,12,16H,7-8,10-11,13-14H2,(H,22,24)(H,25,26) |
| InChIKey | HUPFIEPSGSOJJO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |