C33H35ClN4O4 — CID 118521951
3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-[3-(methoxymethyl)-1,5-dimethylpyrazol-4-yl]-1-(pyridin-3-ylmethyl)indole-2-carboxylic acid (PubChem CID 118521951) has the molecular formula C33H35ClN4O4 and a molecular weight of 587.12 g/mol. Its IUPAC name is 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-[3-(methoxymethyl)-1,5-dimethylpyrazol-4-yl]-1-(pyridin-3-ylmethyl)indole-2-carboxylic acid.
| Compound Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-[3-(methoxymethyl)-1,5-dimethylpyrazol-4-yl]-1-(pyridin-3-ylmethyl)indole-2-carboxylic acid |
|---|---|
| PubChem CID | 118521951 |
| Molecular Formula | C33H35ClN4O4 |
| Molecular Weight | 587.12 g/mol |
| Exact Mass | 586.23 |
| IUPAC Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-[3-(methoxymethyl)-1,5-dimethylpyrazol-4-yl]-1-(pyridin-3-ylmethyl)indole-2-carboxylic acid |
| SMILES | COCc1nn(C)c(C)c1-c1cccc2c(CCCOc3cc(C)c(Cl)c(C)c3)c(C(=O)O)n(Cc3cccnc3)c12 |
| InChI | InChI=1S/C33H35ClN4O4/c1-20-15-24(16-21(2)30(20)34)42-14-8-12-26-25-10-6-11-27(29-22(3)37(4)36-28(29)19-41-5)31(25)38(32(26)33(39)40)18-23-9-7-13-35-17-23/h6-7,9-11,13,15-17H,8,12,14,18-19H2,1-5H3,(H,39,40) |
| InChIKey | NCMKHJJSMTVSDF-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.12 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|