C22H23ClN2O4S — CID 118521974
6-chloro-3-[3-(2,3-dihydro-1H-inden-4-yloxy)propyl]-N-methylsulfonyl-1H-indole-2-carboxamide (PubChem CID 118521974) has the molecular formula C22H23ClN2O4S and a molecular weight of 446.96 g/mol. Its IUPAC name is 6-chloro-3-[3-(2,3-dihydro-1H-inden-4-yloxy)propyl]-N-methylsulfonyl-1H-indole-2-carboxamide.
| Compound Name | 6-chloro-3-[3-(2,3-dihydro-1H-inden-4-yloxy)propyl]-N-methylsulfonyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 118521974 |
| Molecular Formula | C22H23ClN2O4S |
| Molecular Weight | 446.96 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | 6-chloro-3-[3-(2,3-dihydro-1H-inden-4-yloxy)propyl]-N-methylsulfonyl-1H-indole-2-carboxamide |
| SMILES | CS(=O)(=O)NC(=O)c1[nH]c2cc(Cl)ccc2c1CCCOc1cccc2c1CCC2 |
| InChI | InChI=1S/C22H23ClN2O4S/c1-30(27,28)25-22(26)21-18(17-11-10-15(23)13-19(17)24-21)8-4-12-29-20-9-3-6-14-5-2-7-16(14)20/h3,6,9-11,13,24H,2,4-5,7-8,12H2,1H3,(H,25,26) |
| InChIKey | JMEWTBALMSKQJC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.96 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|