C9H12LiNO5S2 — CID 118522860
lithium 2-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethylamino)ethanesulfonate (PubChem CID 118522860) has the molecular formula C9H12LiNO5S2 and a molecular weight of 285.27 g/mol. Its IUPAC name is lithium 2-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethylamino)ethanesulfonate.
| Compound Name | lithium 2-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethylamino)ethanesulfonate |
|---|---|
| PubChem CID | 118522860 |
| Molecular Formula | C9H12LiNO5S2 |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | lithium 2-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethylamino)ethanesulfonate |
| SMILES | O=S(=O)([O-])CCNCC1COc2cscc2O1.[Li+] |
| InChI | InChI=1S/C9H13NO5S2.Li/c11-17(12,13)2-1-10-3-7-4-14-8-5-16-6-9(8)15-7;/h5-7,10H,1-4H2,(H,11,12,13);/q;+1/p-1 |
| InChIKey | JUUXYNBSFWWWRK-UHFFFAOYSA-M |
| XLogP | -2.97 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | -2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|