C9H13NO5S2 — CID 118522888
2-[2,3-dihydrothieno[3,4-b][1,4]dioxin-3-yl(methyl)amino]ethanesulfonic acid (PubChem CID 118522888) has the molecular formula C9H13NO5S2 and a molecular weight of 279.34 g/mol. Its IUPAC name is 2-[2,3-dihydrothieno[3,4-b][1,4]dioxin-3-yl(methyl)amino]ethanesulfonic acid.
| Compound Name | 2-[2,3-dihydrothieno[3,4-b][1,4]dioxin-3-yl(methyl)amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 118522888 |
| Molecular Formula | C9H13NO5S2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | 2-[2,3-dihydrothieno[3,4-b][1,4]dioxin-3-yl(methyl)amino]ethanesulfonic acid |
| SMILES | CN(CCS(=O)(=O)O)C1COc2cscc2O1 |
| InChI | InChI=1S/C9H13NO5S2/c1-10(2-3-17(11,12)13)9-4-14-7-5-16-6-8(7)15-9/h5-6,9H,2-4H2,1H3,(H,11,12,13) |
| InChIKey | JUEXDGUEDKJONQ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|