C12H11NO5S2 — CID 118522894
3-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylamino)benzenesulfonic acid (PubChem CID 118522894) has the molecular formula C12H11NO5S2 and a molecular weight of 313.36 g/mol. Its IUPAC name is 3-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylamino)benzenesulfonic acid.
| Compound Name | 3-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylamino)benzenesulfonic acid |
|---|---|
| PubChem CID | 118522894 |
| Molecular Formula | C12H11NO5S2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.01 |
| IUPAC Name | 3-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylamino)benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1cccc(NC2COc3cscc3O2)c1 |
| InChI | InChI=1S/C12H11NO5S2/c14-20(15,16)9-3-1-2-8(4-9)13-12-5-17-10-6-19-7-11(10)18-12/h1-4,6-7,12-13H,5H2,(H,14,15,16) |
| InChIKey | WIYQRJRVJBATAE-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|