C14H15NO5S2 — CID 118522899
3-[2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethyl(methyl)amino]benzenesulfonic acid (PubChem CID 118522899) has the molecular formula C14H15NO5S2 and a molecular weight of 341.41 g/mol. Its IUPAC name is 3-[2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethyl(methyl)amino]benzenesulfonic acid.
| Compound Name | 3-[2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethyl(methyl)amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 118522899 |
| Molecular Formula | C14H15NO5S2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 3-[2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethyl(methyl)amino]benzenesulfonic acid |
| SMILES | CN(CC1COc2cscc2O1)c1cccc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C14H15NO5S2/c1-15(10-3-2-4-12(5-10)22(16,17)18)6-11-7-19-13-8-21-9-14(13)20-11/h2-5,8-9,11H,6-7H2,1H3,(H,16,17,18) |
| InChIKey | SENYVLIKZLVGQR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|