C11H16LiNO5S2 — CID 118522900
lithium 3-[2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethyl(methyl)amino]propane-1-sulfonate (PubChem CID 118522900) has the molecular formula C11H16LiNO5S2 and a molecular weight of 313.33 g/mol. Its IUPAC name is lithium 3-[2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethyl(methyl)amino]propane-1-sulfonate.
| Compound Name | lithium 3-[2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethyl(methyl)amino]propane-1-sulfonate |
|---|---|
| PubChem CID | 118522900 |
| Molecular Formula | C11H16LiNO5S2 |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | lithium 3-[2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethyl(methyl)amino]propane-1-sulfonate |
| SMILES | CN(CCCS(=O)(=O)[O-])CC1COc2cscc2O1.[Li+] |
| InChI | InChI=1S/C11H17NO5S2.Li/c1-12(3-2-4-19(13,14)15)5-9-6-16-10-7-18-8-11(10)17-9;/h7-9H,2-6H2,1H3,(H,13,14,15);/q;+1/p-1 |
| InChIKey | VRXXZYUWAOYJQL-UHFFFAOYSA-M |
| XLogP | -2.24 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|