C16H30N2O5S2 — CID 118522902
3-[2,3-dihydrothieno[3,4-b][1,4]dioxin-3-yl(methyl)amino]propane-1-sulfonate;triethylazanium (PubChem CID 118522902) has the molecular formula C16H30N2O5S2 and a molecular weight of 394.56 g/mol. Its IUPAC name is 3-[2,3-dihydrothieno[3,4-b][1,4]dioxin-3-yl(methyl)amino]propane-1-sulfonate;triethylazanium.
| Compound Name | 3-[2,3-dihydrothieno[3,4-b][1,4]dioxin-3-yl(methyl)amino]propane-1-sulfonate;triethylazanium |
|---|---|
| PubChem CID | 118522902 |
| Molecular Formula | C16H30N2O5S2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 3-[2,3-dihydrothieno[3,4-b][1,4]dioxin-3-yl(methyl)amino]propane-1-sulfonate;triethylazanium |
| SMILES | CC[NH+](CC)CC.CN(CCCS(=O)(=O)[O-])C1COc2cscc2O1 |
| InChI | InChI=1S/C10H15NO5S2.C6H15N/c1-11(3-2-4-18(12,13)14)10-5-15-8-6-17-7-9(8)16-10;1-4-7(5-2)6-3/h6-7,10H,2-5H2,1H3,(H,12,13,14);4-6H2,1-3H3 |
| InChIKey | UWVJHIDVOMAZAJ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 83.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|