C11H20N2O5S2 — CID 118522906
azanium 4-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethylamino)butane-1-sulfonate (PubChem CID 118522906) has the molecular formula C11H20N2O5S2 and a molecular weight of 324.42 g/mol. Its IUPAC name is azanium 4-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethylamino)butane-1-sulfonate.
| Compound Name | azanium 4-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethylamino)butane-1-sulfonate |
|---|---|
| PubChem CID | 118522906 |
| Molecular Formula | C11H20N2O5S2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | azanium 4-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethylamino)butane-1-sulfonate |
| SMILES | O=S(=O)([O-])CCCCNCC1COc2cscc2O1.[NH4+] |
| InChI | InChI=1S/C11H17NO5S2.H3N/c13-19(14,15)4-2-1-3-12-5-9-6-16-10-7-18-8-11(10)17-9;/h7-9,12H,1-6H2,(H,13,14,15);1H3 |
| InChIKey | QXVKUCTWPCECQD-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 124.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|