C13H13NO5S2 — CID 118522913
3-[2,3-dihydrothieno[3,4-b][1,4]dioxin-3-yl(methyl)amino]benzenesulfonic acid (PubChem CID 118522913) has the molecular formula C13H13NO5S2 and a molecular weight of 327.38 g/mol. Its IUPAC name is 3-[2,3-dihydrothieno[3,4-b][1,4]dioxin-3-yl(methyl)amino]benzenesulfonic acid.
| Compound Name | 3-[2,3-dihydrothieno[3,4-b][1,4]dioxin-3-yl(methyl)amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 118522913 |
| Molecular Formula | C13H13NO5S2 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | 3-[2,3-dihydrothieno[3,4-b][1,4]dioxin-3-yl(methyl)amino]benzenesulfonic acid |
| SMILES | CN(c1cccc(S(=O)(=O)O)c1)C1COc2cscc2O1 |
| InChI | InChI=1S/C13H13NO5S2/c1-14(9-3-2-4-10(5-9)21(15,16)17)13-6-18-11-7-20-8-12(11)19-13/h2-5,7-8,13H,6H2,1H3,(H,15,16,17) |
| InChIKey | SBGJJLFXCJTZMO-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|