C11H16O6S2 — CID 118522915
4-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethoxy)butane-2-sulfonic acid (PubChem CID 118522915) has the molecular formula C11H16O6S2 and a molecular weight of 308.38 g/mol. Its IUPAC name is 4-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethoxy)butane-2-sulfonic acid.
| Compound Name | 4-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethoxy)butane-2-sulfonic acid |
|---|---|
| PubChem CID | 118522915 |
| Molecular Formula | C11H16O6S2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 4-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethoxy)butane-2-sulfonic acid |
| SMILES | CC(CCOCC1COc2cscc2O1)S(=O)(=O)O |
| InChI | InChI=1S/C11H16O6S2/c1-8(19(12,13)14)2-3-15-4-9-5-16-10-6-18-7-11(10)17-9/h6-9H,2-5H2,1H3,(H,12,13,14) |
| InChIKey | DGLHVZNTYXDOSR-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|