C14H14KNO5S2 — CID 118522989
potassium 4-[2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethyl(methyl)amino]benzenesulfonate (PubChem CID 118522989) has the molecular formula C14H14KNO5S2 and a molecular weight of 379.50 g/mol. Its IUPAC name is potassium 4-[2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethyl(methyl)amino]benzenesulfonate.
| Compound Name | potassium 4-[2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethyl(methyl)amino]benzenesulfonate |
|---|---|
| PubChem CID | 118522989 |
| Molecular Formula | C14H14KNO5S2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.00 |
| IUPAC Name | potassium 4-[2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethyl(methyl)amino]benzenesulfonate |
| SMILES | CN(CC1COc2cscc2O1)c1ccc(S(=O)(=O)[O-])cc1.[K+] |
| InChI | InChI=1S/C14H15NO5S2.K/c1-15(10-2-4-12(5-3-10)22(16,17)18)6-11-7-19-13-8-21-9-14(13)20-11;/h2-5,8-9,11H,6-7H2,1H3,(H,16,17,18);/q;+1/p-1 |
| InChIKey | AQQKJXOODNMMII-UHFFFAOYSA-M |
| XLogP | -1.07 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|