C12H10KNO5S2 — CID 118522993
potassium 3-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylamino)benzenesulfonate (PubChem CID 118522993) has the molecular formula C12H10KNO5S2 and a molecular weight of 351.45 g/mol. Its IUPAC name is potassium 3-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylamino)benzenesulfonate.
| Compound Name | potassium 3-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylamino)benzenesulfonate |
|---|---|
| PubChem CID | 118522993 |
| Molecular Formula | C12H10KNO5S2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 350.96 |
| IUPAC Name | potassium 3-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylamino)benzenesulfonate |
| SMILES | O=S(=O)([O-])c1cccc(NC2COc3cscc3O2)c1.[K+] |
| InChI | InChI=1S/C12H11NO5S2.K/c14-20(15,16)9-3-1-2-8(4-9)13-12-5-17-10-6-19-7-11(10)18-12;/h1-4,6-7,12-13H,5H2,(H,14,15,16);/q;+1/p-1 |
| InChIKey | CXTHASFEEKTHTE-UHFFFAOYSA-M |
| XLogP | -1.13 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|