C13H13NO5S2 — CID 118523005
4-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethylamino)benzenesulfonic acid (PubChem CID 118523005) has the molecular formula C13H13NO5S2 and a molecular weight of 327.38 g/mol. Its IUPAC name is 4-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethylamino)benzenesulfonic acid.
| Compound Name | 4-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethylamino)benzenesulfonic acid |
|---|---|
| PubChem CID | 118523005 |
| Molecular Formula | C13H13NO5S2 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | 4-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-ylmethylamino)benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(NCC2COc3cscc3O2)cc1 |
| InChI | InChI=1S/C13H13NO5S2/c15-21(16,17)11-3-1-9(2-4-11)14-5-10-6-18-12-7-20-8-13(12)19-10/h1-4,7-8,10,14H,5-6H2,(H,15,16,17) |
| InChIKey | DIKCQEQLOKCUKK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|