About 6-bromo-7-fluoro-4-[[(1S,3R)-3-hydroxycyclopentyl]amino]quinoline-3-carboxylic acid
6-bromo-7-fluoro-4-[[(1S,3R)-3-hydroxycyclopentyl]amino]quinoline-3-carboxylic acid (PubChem CID 118523363) has the molecular formula C15H14BrFN2O3
and a molecular weight of 369.19 g/mol. Its IUPAC name is 6-bromo-7-fluoro-4-[[(1S,3R)-3-hydroxycyclopentyl]amino]quinoline-3-carboxylic acid.
Molecular Properties
| Compound Name | 6-bromo-7-fluoro-4-[[(1S,3R)-3-hydroxycyclopentyl]amino]quinoline-3-carboxylic acid |
| PubChem CID | 118523363 |
| Molecular Formula | C15H14BrFN2O3 |
| Molecular Weight | 369.19 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | 6-bromo-7-fluoro-4-[[(1S,3R)-3-hydroxycyclopentyl]amino]quinoline-3-carboxylic acid |
| SMILES | O=C(O)c1cnc2cc(F)c(Br)cc2c1N[C@H]1CC[C@@H](O)C1 |
| InChI | InChI=1S/C15H14BrFN2O3/c16-11-4-9-13(5-12(11)17)18-6-10(15(21)22)14(9)19-7-1-2-8(20)3-7/h4-8,20H,1-3H2,(H,18,19)(H,21,22)/t7-,8+/m0/s1 |
| InChIKey | XPDHCUKRZHVEJX-JGVFFNPUSA-N |
| XLogP | 3.16 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.19 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-bromo-7-fluoro-4-[[(1S,3R)-3-hydroxycyclopentyl]amino]quinoline-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-7-fluoro-4-[[(1S,3R)-3-hydroxycyclopentyl]amino]quinoline-3-carboxylic acid?
The IUPAC name of 6-bromo-7-fluoro-4-[[(1S,3R)-3-hydroxycyclopentyl]amino]quinoline-3-carboxylic acid (CID 118523363) is 6-bromo-7-fluoro-4-[[(1S,3R)-3-hydroxycyclopentyl]amino]quinoline-3-carboxylic acid.
What is the SMILES notation for 6-bromo-7-fluoro-4-[[(1S,3R)-3-hydroxycyclopentyl]amino]quinoline-3-carboxylic acid?
The canonical SMILES for 6-bromo-7-fluoro-4-[[(1S,3R)-3-hydroxycyclopentyl]amino]quinoline-3-carboxylic acid is O=C(O)c1cnc2cc(F)c(Br)cc2c1N[C@H]1CC[C@@H](O)C1.
What is the InChIKey of 6-bromo-7-fluoro-4-[[(1S,3R)-3-hydroxycyclopentyl]amino]quinoline-3-carboxylic acid?
The InChIKey is XPDHCUKRZHVEJX-JGVFFNPUSA-N. The full InChI is InChI=1S/C15H14BrFN2O3/c16-11-4-9-13(5-12(11)17)18-6-10(15(21)22)14(9)19-7-1-2-8(20)3-7/h4-8,20H,1-3H2,(H,18,19)(H,21,22)/t7-,8+/m0/s1.
What are the key properties of 6-bromo-7-fluoro-4-[[(1S,3R)-3-hydroxycyclopentyl]amino]quinoline-3-carboxylic acid?
6-bromo-7-fluoro-4-[[(1S,3R)-3-hydroxycyclopentyl]amino]quinoline-3-carboxylic acid has a molecular weight of 369.19 g/mol, XLogP of 3.16, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-7-fluoro-4-[[(1S,3R)-3-hydroxycyclopentyl]amino]quinoline-3-carboxylic acid is sourced from PubChem (CID 118523363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).