C29H34FN5O3 — CID 118523423
7-fluoro-3-methyl-1-(oxan-4-yl)-8-[6-(3-piperidin-1-ylpropoxy)-3-pyridinyl]imidazo[4,5-c]quinolin-2-one (PubChem CID 118523423) has the molecular formula C29H34FN5O3 and a molecular weight of 519.62 g/mol. Its IUPAC name is 7-fluoro-3-methyl-1-(oxan-4-yl)-8-[6-(3-piperidin-1-ylpropoxy)-3-pyridinyl]imidazo[4,5-c]quinolin-2-one.
| Compound Name | 7-fluoro-3-methyl-1-(oxan-4-yl)-8-[6-(3-piperidin-1-ylpropoxy)-3-pyridinyl]imidazo[4,5-c]quinolin-2-one |
|---|---|
| PubChem CID | 118523423 |
| Molecular Formula | C29H34FN5O3 |
| Molecular Weight | 519.62 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | 7-fluoro-3-methyl-1-(oxan-4-yl)-8-[6-(3-piperidin-1-ylpropoxy)-3-pyridinyl]imidazo[4,5-c]quinolin-2-one |
| SMILES | Cn1c(=O)n(C2CCOCC2)c2c3cc(-c4ccc(OCCCN5CCCCC5)nc4)c(F)cc3ncc21 |
| InChI | InChI=1S/C29H34FN5O3/c1-33-26-19-31-25-17-24(30)22(16-23(25)28(26)35(29(33)36)21-8-14-37-15-9-21)20-6-7-27(32-18-20)38-13-5-12-34-10-3-2-4-11-34/h6-7,16-19,21H,2-5,8-15H2,1H3 |
| InChIKey | QHRPXFUAYFWEPQ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 74.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.62 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|