C17H23N3O5S2 — CID 118523687
[(1R,2S,3S,5R)-5-(3-isothiocyanato-4-pyridinyl)-3-methyl-2-(2-methylsulfonylethoxy)cyclohexyl]carbamic acid (PubChem CID 118523687) has the molecular formula C17H23N3O5S2 and a molecular weight of 413.52 g/mol. Its IUPAC name is [(1R,2S,3S,5R)-5-(3-isothiocyanato-4-pyridinyl)-3-methyl-2-(2-methylsulfonylethoxy)cyclohexyl]carbamic acid.
| Compound Name | [(1R,2S,3S,5R)-5-(3-isothiocyanato-4-pyridinyl)-3-methyl-2-(2-methylsulfonylethoxy)cyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 118523687 |
| Molecular Formula | C17H23N3O5S2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | [(1R,2S,3S,5R)-5-(3-isothiocyanato-4-pyridinyl)-3-methyl-2-(2-methylsulfonylethoxy)cyclohexyl]carbamic acid |
| SMILES | CC1C[C@@H](c2ccncc2N=C=S)C[C@@H](NC(=O)O)[C@H]1OCCS(C)(=O)=O |
| InChI | InChI=1S/C17H23N3O5S2/c1-11-7-12(13-3-4-18-9-15(13)19-10-26)8-14(20-17(21)22)16(11)25-5-6-27(2,23)24/h3-4,9,11-12,14,16,20H,5-8H2,1-2H3,(H,21,22)/t11?,12-,14-,16+/m1/s1 |
| InChIKey | XANZXODTXCNEIU-USEPLDAASA-N |
| XLogP | 2.40 |
| TPSA | 117.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|