C53H36N4O6 — CID 118524408
[(2R)-5-phenyl-2-[(2S)-5-phenyl-2,3-dihydro-1,3-benzoxazol-2-yl]-3H-1,3-benzoxazol-2-yl] 2-[2-[(6-oxo-5H-phenanthridin-3-yl)carbamoyl]phenyl]benzoate (PubChem CID 118524408) has the molecular formula C53H36N4O6 and a molecular weight of 824.89 g/mol. Its IUPAC name is [(2R)-5-phenyl-2-[(2S)-5-phenyl-2,3-dihydro-1,3-benzoxazol-2-yl]-3H-1,3-benzoxazol-2-yl] 2-[2-[(6-oxo-5H-phenanthridin-3-yl)carbamoyl]phenyl]benzoate.
| Compound Name | [(2R)-5-phenyl-2-[(2S)-5-phenyl-2,3-dihydro-1,3-benzoxazol-2-yl]-3H-1,3-benzoxazol-2-yl] 2-[2-[(6-oxo-5H-phenanthridin-3-yl)carbamoyl]phenyl]benzoate |
|---|---|
| PubChem CID | 118524408 |
| Molecular Formula | C53H36N4O6 |
| Molecular Weight | 824.89 g/mol |
| Exact Mass | 824.26 |
| IUPAC Name | [(2R)-5-phenyl-2-[(2S)-5-phenyl-2,3-dihydro-1,3-benzoxazol-2-yl]-3H-1,3-benzoxazol-2-yl] 2-[2-[(6-oxo-5H-phenanthridin-3-yl)carbamoyl]phenyl]benzoate |
| SMILES | O=C(Nc1ccc2c(c1)[nH]c(=O)c1ccccc12)c1ccccc1-c1ccccc1C(=O)O[C@]1([C@H]2Nc3cc(-c4ccccc4)ccc3O2)Nc2cc(-c3ccccc3)ccc2O1 |
| InChI | InChI=1S/C53H36N4O6/c58-49(54-36-25-26-40-39-19-8-11-21-42(39)50(59)55-44(40)31-36)41-20-10-7-17-37(41)38-18-9-12-22-43(38)51(60)63-53(57-46-30-35(24-28-48(46)62-53)33-15-5-2-6-16-33)52-56-45-29-34(23-27-47(45)61-52)32-13-3-1-4-14-32/h1-31,52,56-57H,(H,54,58)(H,55,59)/t52-,53+/m0/s1 |
| InChIKey | SSNSNYQATOBPDQ-SSGPOVAZSA-N |
| XLogP | 11.08 |
| TPSA | 130.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.89 |
| LogP ≤ 5 | 11.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|