About 4,5-dimethyl-2-(1,3-thiazol-2-ylsulfanyl)-1,3-thiazole
4,5-dimethyl-2-(1,3-thiazol-2-ylsulfanyl)-1,3-thiazole (PubChem CID 118524512) has the molecular formula C8H8N2S3
and a molecular weight of 228.37 g/mol. Its IUPAC name is 4,5-dimethyl-2-(1,3-thiazol-2-ylsulfanyl)-1,3-thiazole.
Molecular Properties
| Compound Name | 4,5-dimethyl-2-(1,3-thiazol-2-ylsulfanyl)-1,3-thiazole |
| PubChem CID | 118524512 |
| Molecular Formula | C8H8N2S3 |
| Molecular Weight | 228.37 g/mol |
| Exact Mass | 227.98 |
| IUPAC Name | 4,5-dimethyl-2-(1,3-thiazol-2-ylsulfanyl)-1,3-thiazole |
| SMILES | Cc1nc(Sc2nccs2)sc1C |
| InChI | InChI=1S/C8H8N2S3/c1-5-6(2)12-8(10-5)13-7-9-3-4-11-7/h3-4H,1-2H3 |
| InChIKey | WSKYIZZVWYGGBT-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.37 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dimethyl-2-(1,3-thiazol-2-ylsulfanyl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-2-(1,3-thiazol-2-ylsulfanyl)-1,3-thiazole?
The IUPAC name of 4,5-dimethyl-2-(1,3-thiazol-2-ylsulfanyl)-1,3-thiazole (CID 118524512) is 4,5-dimethyl-2-(1,3-thiazol-2-ylsulfanyl)-1,3-thiazole.
What is the SMILES notation for 4,5-dimethyl-2-(1,3-thiazol-2-ylsulfanyl)-1,3-thiazole?
The canonical SMILES for 4,5-dimethyl-2-(1,3-thiazol-2-ylsulfanyl)-1,3-thiazole is Cc1nc(Sc2nccs2)sc1C.
What is the InChIKey of 4,5-dimethyl-2-(1,3-thiazol-2-ylsulfanyl)-1,3-thiazole?
The InChIKey is WSKYIZZVWYGGBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2S3/c1-5-6(2)12-8(10-5)13-7-9-3-4-11-7/h3-4H,1-2H3.
What are the key properties of 4,5-dimethyl-2-(1,3-thiazol-2-ylsulfanyl)-1,3-thiazole?
4,5-dimethyl-2-(1,3-thiazol-2-ylsulfanyl)-1,3-thiazole has a molecular weight of 228.37 g/mol, XLogP of 3.37, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-2-(1,3-thiazol-2-ylsulfanyl)-1,3-thiazole is sourced from PubChem (CID 118524512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).