About 5,6-dibromo-4-nitro-2-piperazin-1-yl-1-prop-2-ynylbenzimidazole;hydrochloride
5,6-dibromo-4-nitro-2-piperazin-1-yl-1-prop-2-ynylbenzimidazole;hydrochloride (PubChem CID 118524567) has the molecular formula C14H14Br2ClN5O2
and a molecular weight of 479.56 g/mol. Its IUPAC name is 5,6-dibromo-4-nitro-2-piperazin-1-yl-1-prop-2-ynylbenzimidazole;hydrochloride.
Molecular Properties
| Compound Name | 5,6-dibromo-4-nitro-2-piperazin-1-yl-1-prop-2-ynylbenzimidazole;hydrochloride |
| PubChem CID | 118524567 |
| Molecular Formula | C14H14Br2ClN5O2 |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 476.92 |
| IUPAC Name | 5,6-dibromo-4-nitro-2-piperazin-1-yl-1-prop-2-ynylbenzimidazole;hydrochloride |
| SMILES | C#CCn1c(N2CCNCC2)nc2c([N+](=O)[O-])c(Br)c(Br)cc21.Cl |
| InChI | InChI=1S/C14H13Br2N5O2.ClH/c1-2-5-20-10-8-9(15)11(16)13(21(22)23)12(10)18-14(20)19-6-3-17-4-7-19;/h1,8,17H,3-7H2;1H |
| InChIKey | XDVVGPCNPDDCAS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dibromo-4-nitro-2-piperazin-1-yl-1-prop-2-ynylbenzimidazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dibromo-4-nitro-2-piperazin-1-yl-1-prop-2-ynylbenzimidazole;hydrochloride?
The IUPAC name of 5,6-dibromo-4-nitro-2-piperazin-1-yl-1-prop-2-ynylbenzimidazole;hydrochloride (CID 118524567) is 5,6-dibromo-4-nitro-2-piperazin-1-yl-1-prop-2-ynylbenzimidazole;hydrochloride.
What is the SMILES notation for 5,6-dibromo-4-nitro-2-piperazin-1-yl-1-prop-2-ynylbenzimidazole;hydrochloride?
The canonical SMILES for 5,6-dibromo-4-nitro-2-piperazin-1-yl-1-prop-2-ynylbenzimidazole;hydrochloride is C#CCn1c(N2CCNCC2)nc2c([N+](=O)[O-])c(Br)c(Br)cc21.Cl.
What is the InChIKey of 5,6-dibromo-4-nitro-2-piperazin-1-yl-1-prop-2-ynylbenzimidazole;hydrochloride?
The InChIKey is XDVVGPCNPDDCAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13Br2N5O2.ClH/c1-2-5-20-10-8-9(15)11(16)13(21(22)23)12(10)18-14(20)19-6-3-17-4-7-19;/h1,8,17H,3-7H2;1H.
What are the key properties of 5,6-dibromo-4-nitro-2-piperazin-1-yl-1-prop-2-ynylbenzimidazole;hydrochloride?
5,6-dibromo-4-nitro-2-piperazin-1-yl-1-prop-2-ynylbenzimidazole;hydrochloride has a molecular weight of 479.56 g/mol, XLogP of 2.93, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dibromo-4-nitro-2-piperazin-1-yl-1-prop-2-ynylbenzimidazole;hydrochloride is sourced from PubChem (CID 118524567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).