C10H16F3N3O5S — CID 118524699
methanesulfonic acid;2,2,2-trifluoro-1-(5-methoxyimino-2,7-diazaspiro[3.4]octan-2-yl)ethanone (PubChem CID 118524699) has the molecular formula C10H16F3N3O5S and a molecular weight of 347.32 g/mol. Its IUPAC name is methanesulfonic acid;2,2,2-trifluoro-1-(5-methoxyimino-2,7-diazaspiro[3.4]octan-2-yl)ethanone.
| Compound Name | methanesulfonic acid;2,2,2-trifluoro-1-(5-methoxyimino-2,7-diazaspiro[3.4]octan-2-yl)ethanone |
|---|---|
| PubChem CID | 118524699 |
| Molecular Formula | C10H16F3N3O5S |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | methanesulfonic acid;2,2,2-trifluoro-1-(5-methoxyimino-2,7-diazaspiro[3.4]octan-2-yl)ethanone |
| SMILES | CON=C1CNCC12CN(C(=O)C(F)(F)F)C2.CS(=O)(=O)O |
| InChI | InChI=1S/C9H12F3N3O2.CH4O3S/c1-17-14-6-2-13-3-8(6)4-15(5-8)7(16)9(10,11)12;1-5(2,3)4/h13H,2-5H2,1H3;1H3,(H,2,3,4) |
| InChIKey | DFJILJPEHFSJGJ-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|