About 3-[[4-(2,3-dihydro-1,4-benzodioxin-6-yl)phenyl]methoxy]azetidine-1-carbonitrile
3-[[4-(2,3-dihydro-1,4-benzodioxin-6-yl)phenyl]methoxy]azetidine-1-carbonitrile (PubChem CID 118524788) has the molecular formula C19H18N2O3
and a molecular weight of 322.36 g/mol. Its IUPAC name is 3-[[4-(2,3-dihydro-1,4-benzodioxin-6-yl)phenyl]methoxy]azetidine-1-carbonitrile.
Molecular Properties
| Compound Name | 3-[[4-(2,3-dihydro-1,4-benzodioxin-6-yl)phenyl]methoxy]azetidine-1-carbonitrile |
| PubChem CID | 118524788 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 3-[[4-(2,3-dihydro-1,4-benzodioxin-6-yl)phenyl]methoxy]azetidine-1-carbonitrile |
| SMILES | N#CN1CC(OCc2ccc(-c3ccc4c(c3)OCCO4)cc2)C1 |
| InChI | InChI=1S/C19H18N2O3/c20-13-21-10-17(11-21)24-12-14-1-3-15(4-2-14)16-5-6-18-19(9-16)23-8-7-22-18/h1-6,9,17H,7-8,10-12H2 |
| InChIKey | GDQRDECPLYKMNW-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 54.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze 3-[[4-(2,3-dihydro-1,4-benzodioxin-6-yl)phenyl]methoxy]azetidine-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-(2,3-dihydro-1,4-benzodioxin-6-yl)phenyl]methoxy]azetidine-1-carbonitrile?
The IUPAC name of 3-[[4-(2,3-dihydro-1,4-benzodioxin-6-yl)phenyl]methoxy]azetidine-1-carbonitrile (CID 118524788) is 3-[[4-(2,3-dihydro-1,4-benzodioxin-6-yl)phenyl]methoxy]azetidine-1-carbonitrile.
What is the SMILES notation for 3-[[4-(2,3-dihydro-1,4-benzodioxin-6-yl)phenyl]methoxy]azetidine-1-carbonitrile?
The canonical SMILES for 3-[[4-(2,3-dihydro-1,4-benzodioxin-6-yl)phenyl]methoxy]azetidine-1-carbonitrile is N#CN1CC(OCc2ccc(-c3ccc4c(c3)OCCO4)cc2)C1.
What is the InChIKey of 3-[[4-(2,3-dihydro-1,4-benzodioxin-6-yl)phenyl]methoxy]azetidine-1-carbonitrile?
The InChIKey is GDQRDECPLYKMNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O3/c20-13-21-10-17(11-21)24-12-14-1-3-15(4-2-14)16-5-6-18-19(9-16)23-8-7-22-18/h1-6,9,17H,7-8,10-12H2.
What are the key properties of 3-[[4-(2,3-dihydro-1,4-benzodioxin-6-yl)phenyl]methoxy]azetidine-1-carbonitrile?
3-[[4-(2,3-dihydro-1,4-benzodioxin-6-yl)phenyl]methoxy]azetidine-1-carbonitrile has a molecular weight of 322.36 g/mol, XLogP of 2.81, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-(2,3-dihydro-1,4-benzodioxin-6-yl)phenyl]methoxy]azetidine-1-carbonitrile is sourced from PubChem (CID 118524788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).