About N-hex-1-ynylpropanamide
N-hex-1-ynylpropanamide (PubChem CID 118524998) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is N-hex-1-ynylpropanamide.
Molecular Properties
| Compound Name | N-hex-1-ynylpropanamide |
| PubChem CID | 118524998 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | N-hex-1-ynylpropanamide |
| SMILES | CCCCC#CNC(=O)CC |
| InChI | InChI=1S/C9H15NO/c1-3-5-6-7-8-10-9(11)4-2/h3-6H2,1-2H3,(H,10,11) |
| InChIKey | UOULWFOMVHDIHG-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hex-1-ynylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hex-1-ynylpropanamide?
The IUPAC name of N-hex-1-ynylpropanamide (CID 118524998) is N-hex-1-ynylpropanamide.
What is the SMILES notation for N-hex-1-ynylpropanamide?
The canonical SMILES for N-hex-1-ynylpropanamide is CCCCC#CNC(=O)CC.
What is the InChIKey of N-hex-1-ynylpropanamide?
The InChIKey is UOULWFOMVHDIHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO/c1-3-5-6-7-8-10-9(11)4-2/h3-6H2,1-2H3,(H,10,11).
What are the key properties of N-hex-1-ynylpropanamide?
N-hex-1-ynylpropanamide has a molecular weight of 153.22 g/mol, XLogP of 1.66, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-hex-1-ynylpropanamide is sourced from PubChem (CID 118524998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).