C23H22FN5O3 — CID 118525075
1-[(3R)-3-[[6-[3-(2-fluoro-6-methoxyphenoxy)prop-1-ynyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 118525075) has the molecular formula C23H22FN5O3 and a molecular weight of 435.46 g/mol. Its IUPAC name is 1-[(3R)-3-[[6-[3-(2-fluoro-6-methoxyphenoxy)prop-1-ynyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3R)-3-[[6-[3-(2-fluoro-6-methoxyphenoxy)prop-1-ynyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 118525075 |
| Molecular Formula | C23H22FN5O3 |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 1-[(3R)-3-[[6-[3-(2-fluoro-6-methoxyphenoxy)prop-1-ynyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC[C@@H](Nc2ncnc3[nH]c(C#CCOc4c(F)cccc4OC)cc23)C1 |
| InChI | InChI=1S/C23H22FN5O3/c1-3-20(30)29-10-9-16(13-29)28-23-17-12-15(27-22(17)25-14-26-23)6-5-11-32-21-18(24)7-4-8-19(21)31-2/h3-4,7-8,12,14,16H,1,9-11,13H2,2H3,(H2,25,26,27,28)/t16-/m1/s1 |
| InChIKey | YGVCTICDTKMBJJ-MRXNPFEDSA-N |
| XLogP | 2.73 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|