C22H19F2N5O2 — CID 118525082
1-[3-[[6-[3-(2,5-difluorophenoxy)prop-1-ynyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 118525082) has the molecular formula C22H19F2N5O2 and a molecular weight of 423.42 g/mol. Its IUPAC name is 1-[3-[[6-[3-(2,5-difluorophenoxy)prop-1-ynyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[[6-[3-(2,5-difluorophenoxy)prop-1-ynyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 118525082 |
| Molecular Formula | C22H19F2N5O2 |
| Molecular Weight | 423.42 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 1-[3-[[6-[3-(2,5-difluorophenoxy)prop-1-ynyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(Nc2ncnc3[nH]c(C#CCOc4cc(F)ccc4F)cc23)C1 |
| InChI | InChI=1S/C22H19F2N5O2/c1-2-20(30)29-8-7-16(12-29)28-22-17-11-15(27-21(17)25-13-26-22)4-3-9-31-19-10-14(23)5-6-18(19)24/h2,5-6,10-11,13,16H,1,7-9,12H2,(H2,25,26,27,28) |
| InChIKey | GOHZVCHNXJABHL-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|