C26H30N6O2 — CID 118525096
(E)-4-(dimethylamino)-1-[3-[methyl-[6-(3-phenoxyprop-1-ynyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]pyrrolidin-1-yl]but-2-en-1-one (PubChem CID 118525096) has the molecular formula C26H30N6O2 and a molecular weight of 458.57 g/mol. Its IUPAC name is (E)-4-(dimethylamino)-1-[3-[methyl-[6-(3-phenoxyprop-1-ynyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]pyrrolidin-1-yl]but-2-en-1-one.
| Compound Name | (E)-4-(dimethylamino)-1-[3-[methyl-[6-(3-phenoxyprop-1-ynyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]pyrrolidin-1-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 118525096 |
| Molecular Formula | C26H30N6O2 |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | (E)-4-(dimethylamino)-1-[3-[methyl-[6-(3-phenoxyprop-1-ynyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]pyrrolidin-1-yl]but-2-en-1-one |
| SMILES | CN(C)C/C=C/C(=O)N1CCC(N(C)c2ncnc3[nH]c(C#CCOc4ccccc4)cc23)C1 |
| InChI | InChI=1S/C26H30N6O2/c1-30(2)14-7-12-24(33)32-15-13-21(18-32)31(3)26-23-17-20(29-25(23)27-19-28-26)9-8-16-34-22-10-5-4-6-11-22/h4-7,10-12,17,19,21H,13-16,18H2,1-3H3,(H,27,28,29)/b12-7+ |
| InChIKey | FUBYTXRFSZJBSC-KPKJPENVSA-N |
| XLogP | 2.54 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|