About (2S)-2-amino-1-(1H-1,2,4-triazol-5-yl)propan-1-ol
(2S)-2-amino-1-(1H-1,2,4-triazol-5-yl)propan-1-ol (PubChem CID 118525717) has the molecular formula C5H10N4O
and a molecular weight of 142.16 g/mol. Its IUPAC name is (2S)-2-amino-1-(1H-1,2,4-triazol-5-yl)propan-1-ol.
Molecular Properties
| Compound Name | (2S)-2-amino-1-(1H-1,2,4-triazol-5-yl)propan-1-ol |
| PubChem CID | 118525717 |
| Molecular Formula | C5H10N4O |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.09 |
| IUPAC Name | (2S)-2-amino-1-(1H-1,2,4-triazol-5-yl)propan-1-ol |
| SMILES | C[C@H](N)C(O)c1ncn[nH]1 |
| InChI | InChI=1S/C5H10N4O/c1-3(6)4(10)5-7-2-8-9-5/h2-4,10H,6H2,1H3,(H,7,8,9)/t3-,4?/m0/s1 |
| InChIKey | BWPAQCKFFSCPJZ-WUCPZUCCSA-N |
| XLogP | -0.81 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-2-amino-1-(1H-1,2,4-triazol-5-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-1-(1H-1,2,4-triazol-5-yl)propan-1-ol?
The IUPAC name of (2S)-2-amino-1-(1H-1,2,4-triazol-5-yl)propan-1-ol (CID 118525717) is (2S)-2-amino-1-(1H-1,2,4-triazol-5-yl)propan-1-ol.
What is the SMILES notation for (2S)-2-amino-1-(1H-1,2,4-triazol-5-yl)propan-1-ol?
The canonical SMILES for (2S)-2-amino-1-(1H-1,2,4-triazol-5-yl)propan-1-ol is C[C@H](N)C(O)c1ncn[nH]1.
What is the InChIKey of (2S)-2-amino-1-(1H-1,2,4-triazol-5-yl)propan-1-ol?
The InChIKey is BWPAQCKFFSCPJZ-WUCPZUCCSA-N. The full InChI is InChI=1S/C5H10N4O/c1-3(6)4(10)5-7-2-8-9-5/h2-4,10H,6H2,1H3,(H,7,8,9)/t3-,4?/m0/s1.
What are the key properties of (2S)-2-amino-1-(1H-1,2,4-triazol-5-yl)propan-1-ol?
(2S)-2-amino-1-(1H-1,2,4-triazol-5-yl)propan-1-ol has a molecular weight of 142.16 g/mol, XLogP of -0.81, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-1-(1H-1,2,4-triazol-5-yl)propan-1-ol is sourced from PubChem (CID 118525717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).