C19H18N4O — CID 118526116
1,3,3-trimethyl-6-(2-pyridin-4-yl-1H-imidazol-5-yl)indol-2-one (PubChem CID 118526116) has the molecular formula C19H18N4O and a molecular weight of 318.38 g/mol. Its IUPAC name is 1,3,3-trimethyl-6-(2-pyridin-4-yl-1H-imidazol-5-yl)indol-2-one.
| Compound Name | 1,3,3-trimethyl-6-(2-pyridin-4-yl-1H-imidazol-5-yl)indol-2-one |
|---|---|
| PubChem CID | 118526116 |
| Molecular Formula | C19H18N4O |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 1,3,3-trimethyl-6-(2-pyridin-4-yl-1H-imidazol-5-yl)indol-2-one |
| SMILES | CN1C(=O)C(C)(C)c2ccc(-c3cnc(-c4ccncc4)[nH]3)cc21 |
| InChI | InChI=1S/C19H18N4O/c1-19(2)14-5-4-13(10-16(14)23(3)18(19)24)15-11-21-17(22-15)12-6-8-20-9-7-12/h4-11H,1-3H3,(H,21,22) |
| InChIKey | CDGMOROQPLSTPW-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |