About ethyl 8-fluoro-4,4-dimethyl-1-[2-(trifluoromethyl)phenyl]-3H-isoquinoline-7-carboxylate
ethyl 8-fluoro-4,4-dimethyl-1-[2-(trifluoromethyl)phenyl]-3H-isoquinoline-7-carboxylate (PubChem CID 118526367) has the molecular formula C21H19F4NO2
and a molecular weight of 393.38 g/mol. Its IUPAC name is ethyl 8-fluoro-4,4-dimethyl-1-[2-(trifluoromethyl)phenyl]-3H-isoquinoline-7-carboxylate.
Molecular Properties
| Compound Name | ethyl 8-fluoro-4,4-dimethyl-1-[2-(trifluoromethyl)phenyl]-3H-isoquinoline-7-carboxylate |
| PubChem CID | 118526367 |
| Molecular Formula | C21H19F4NO2 |
| Molecular Weight | 393.38 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | ethyl 8-fluoro-4,4-dimethyl-1-[2-(trifluoromethyl)phenyl]-3H-isoquinoline-7-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1F)C(c1ccccc1C(F)(F)F)=NCC2(C)C |
| InChI | InChI=1S/C21H19F4NO2/c1-4-28-19(27)13-9-10-15-16(17(13)22)18(26-11-20(15,2)3)12-7-5-6-8-14(12)21(23,24)25/h5-10H,4,11H2,1-3H3 |
| InChIKey | SUYNNKFECKOSDE-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.38 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 8-fluoro-4,4-dimethyl-1-[2-(trifluoromethyl)phenyl]-3H-isoquinoline-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 8-fluoro-4,4-dimethyl-1-[2-(trifluoromethyl)phenyl]-3H-isoquinoline-7-carboxylate?
The IUPAC name of ethyl 8-fluoro-4,4-dimethyl-1-[2-(trifluoromethyl)phenyl]-3H-isoquinoline-7-carboxylate (CID 118526367) is ethyl 8-fluoro-4,4-dimethyl-1-[2-(trifluoromethyl)phenyl]-3H-isoquinoline-7-carboxylate.
What is the SMILES notation for ethyl 8-fluoro-4,4-dimethyl-1-[2-(trifluoromethyl)phenyl]-3H-isoquinoline-7-carboxylate?
The canonical SMILES for ethyl 8-fluoro-4,4-dimethyl-1-[2-(trifluoromethyl)phenyl]-3H-isoquinoline-7-carboxylate is CCOC(=O)c1ccc2c(c1F)C(c1ccccc1C(F)(F)F)=NCC2(C)C.
What is the InChIKey of ethyl 8-fluoro-4,4-dimethyl-1-[2-(trifluoromethyl)phenyl]-3H-isoquinoline-7-carboxylate?
The InChIKey is SUYNNKFECKOSDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19F4NO2/c1-4-28-19(27)13-9-10-15-16(17(13)22)18(26-11-20(15,2)3)12-7-5-6-8-14(12)21(23,24)25/h5-10H,4,11H2,1-3H3.
What are the key properties of ethyl 8-fluoro-4,4-dimethyl-1-[2-(trifluoromethyl)phenyl]-3H-isoquinoline-7-carboxylate?
ethyl 8-fluoro-4,4-dimethyl-1-[2-(trifluoromethyl)phenyl]-3H-isoquinoline-7-carboxylate has a molecular weight of 393.38 g/mol, XLogP of 5.15, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 8-fluoro-4,4-dimethyl-1-[2-(trifluoromethyl)phenyl]-3H-isoquinoline-7-carboxylate is sourced from PubChem (CID 118526367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).