C24H28N2O4S — CID 11852642
3-[2,6-dimethyl-4-[3-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]-1,2,4-oxadiazol-5-yl]phenoxy]propane-1,2-diol (PubChem CID 11852642) has the molecular formula C24H28N2O4S and a molecular weight of 440.57 g/mol. Its IUPAC name is 3-[2,6-dimethyl-4-[3-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]-1,2,4-oxadiazol-5-yl]phenoxy]propane-1,2-diol.
| Compound Name | 3-[2,6-dimethyl-4-[3-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]-1,2,4-oxadiazol-5-yl]phenoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 11852642 |
| Molecular Formula | C24H28N2O4S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 3-[2,6-dimethyl-4-[3-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]-1,2,4-oxadiazol-5-yl]phenoxy]propane-1,2-diol |
| SMILES | Cc1cc(-c2nc(-c3sc(C)c4c3C[C@@H]3[C@H]4C3(C)C)no2)cc(C)c1OCC(O)CO |
| InChI | InChI=1S/C24H28N2O4S/c1-11-6-14(7-12(2)20(11)29-10-15(28)9-27)23-25-22(26-30-23)21-16-8-17-19(24(17,4)5)18(16)13(3)31-21/h6-7,15,17,19,27-28H,8-10H2,1-5H3/t15?,17-,19-/m1/s1 |
| InChIKey | PADINSMRACGWMQ-GERZZCHPSA-N |
| XLogP | 4.42 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |