About 2-amino-4,5-dihydrocyclopenta[d][1,3]thiazol-6-one
2-amino-4,5-dihydrocyclopenta[d][1,3]thiazol-6-one (PubChem CID 11852658) has the molecular formula C6H6N2OS
and a molecular weight of 154.19 g/mol. Its IUPAC name is 2-amino-4,5-dihydrocyclopenta[d][1,3]thiazol-6-one.
Molecular Properties
| Compound Name | 2-amino-4,5-dihydrocyclopenta[d][1,3]thiazol-6-one |
| PubChem CID | 11852658 |
| Molecular Formula | C6H6N2OS |
| Molecular Weight | 154.19 g/mol |
| Exact Mass | 154.02 |
| IUPAC Name | 2-amino-4,5-dihydrocyclopenta[d][1,3]thiazol-6-one |
| SMILES | Nc1nc2c(s1)C(=O)CC2 |
| InChI | InChI=1S/C6H6N2OS/c7-6-8-3-1-2-4(9)5(3)10-6/h1-2H2,(H2,7,8) |
| InChIKey | WWCOWASLMPTQDE-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.19 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-4,5-dihydrocyclopenta[d][1,3]thiazol-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4,5-dihydrocyclopenta[d][1,3]thiazol-6-one?
The IUPAC name of 2-amino-4,5-dihydrocyclopenta[d][1,3]thiazol-6-one (CID 11852658) is 2-amino-4,5-dihydrocyclopenta[d][1,3]thiazol-6-one.
What is the SMILES notation for 2-amino-4,5-dihydrocyclopenta[d][1,3]thiazol-6-one?
The canonical SMILES for 2-amino-4,5-dihydrocyclopenta[d][1,3]thiazol-6-one is Nc1nc2c(s1)C(=O)CC2.
What is the InChIKey of 2-amino-4,5-dihydrocyclopenta[d][1,3]thiazol-6-one?
The InChIKey is WWCOWASLMPTQDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2OS/c7-6-8-3-1-2-4(9)5(3)10-6/h1-2H2,(H2,7,8).
What are the key properties of 2-amino-4,5-dihydrocyclopenta[d][1,3]thiazol-6-one?
2-amino-4,5-dihydrocyclopenta[d][1,3]thiazol-6-one has a molecular weight of 154.19 g/mol, XLogP of 0.85, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4,5-dihydrocyclopenta[d][1,3]thiazol-6-one is sourced from PubChem (CID 11852658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).