C21H30N4O4S2 — CID 118526913
N-benzyl-N-(2-methylpropyl)-6-(4-methylsulfonylpiperazin-1-yl)pyridine-3-sulfonamide (PubChem CID 118526913) has the molecular formula C21H30N4O4S2 and a molecular weight of 466.63 g/mol. Its IUPAC name is N-benzyl-N-(2-methylpropyl)-6-(4-methylsulfonylpiperazin-1-yl)pyridine-3-sulfonamide.
| Compound Name | N-benzyl-N-(2-methylpropyl)-6-(4-methylsulfonylpiperazin-1-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 118526913 |
| Molecular Formula | C21H30N4O4S2 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | N-benzyl-N-(2-methylpropyl)-6-(4-methylsulfonylpiperazin-1-yl)pyridine-3-sulfonamide |
| SMILES | CC(C)CN(Cc1ccccc1)S(=O)(=O)c1ccc(N2CCN(S(C)(=O)=O)CC2)nc1 |
| InChI | InChI=1S/C21H30N4O4S2/c1-18(2)16-25(17-19-7-5-4-6-8-19)31(28,29)20-9-10-21(22-15-20)23-11-13-24(14-12-23)30(3,26)27/h4-10,15,18H,11-14,16-17H2,1-3H3 |
| InChIKey | OVEADGKOCGVCJY-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 90.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |