C15H28F2O — CID 118527056
(E)-10-ethoxy-3,3-difluoro-2,9,9-trimethyldec-4-ene (PubChem CID 118527056) has the molecular formula C15H28F2O and a molecular weight of 262.38 g/mol. Its IUPAC name is (E)-10-ethoxy-3,3-difluoro-2,9,9-trimethyldec-4-ene.
| Compound Name | (E)-10-ethoxy-3,3-difluoro-2,9,9-trimethyldec-4-ene |
|---|---|
| PubChem CID | 118527056 |
| Molecular Formula | C15H28F2O |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.21 |
| IUPAC Name | (E)-10-ethoxy-3,3-difluoro-2,9,9-trimethyldec-4-ene |
| SMILES | CCOCC(C)(C)CCC/C=C/C(F)(F)C(C)C |
| InChI | InChI=1S/C15H28F2O/c1-6-18-12-14(4,5)10-8-7-9-11-15(16,17)13(2)3/h9,11,13H,6-8,10,12H2,1-5H3/b11-9+ |
| InChIKey | XMJYIJPINNRNIA-PKNBQFBNSA-N |
| XLogP | 5.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|