C13H24F2O — CID 118527066
(E)-1-ethoxy-6,6-difluoro-2,2,7-trimethyloct-4-ene (PubChem CID 118527066) has the molecular formula C13H24F2O and a molecular weight of 234.33 g/mol. Its IUPAC name is (E)-1-ethoxy-6,6-difluoro-2,2,7-trimethyloct-4-ene.
| Compound Name | (E)-1-ethoxy-6,6-difluoro-2,2,7-trimethyloct-4-ene |
|---|---|
| PubChem CID | 118527066 |
| Molecular Formula | C13H24F2O |
| Molecular Weight | 234.33 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | (E)-1-ethoxy-6,6-difluoro-2,2,7-trimethyloct-4-ene |
| SMILES | CCOCC(C)(C)C/C=C/C(F)(F)C(C)C |
| InChI | InChI=1S/C13H24F2O/c1-6-16-10-12(4,5)8-7-9-13(14,15)11(2)3/h7,9,11H,6,8,10H2,1-5H3/b9-7+ |
| InChIKey | CNCCTLFOMREUKI-VQHVLOKHSA-N |
| XLogP | 4.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.33 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|