C14H19F3N4 — CID 118527422
3-[[1-(4-ethylphenyl)-2,2,2-trifluoroethyl]amino]azetidine-1-carboximidamide (PubChem CID 118527422) has the molecular formula C14H19F3N4 and a molecular weight of 300.33 g/mol. Its IUPAC name is 3-[[1-(4-ethylphenyl)-2,2,2-trifluoroethyl]amino]azetidine-1-carboximidamide.
| Compound Name | 3-[[1-(4-ethylphenyl)-2,2,2-trifluoroethyl]amino]azetidine-1-carboximidamide |
|---|---|
| PubChem CID | 118527422 |
| Molecular Formula | C14H19F3N4 |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 3-[[1-(4-ethylphenyl)-2,2,2-trifluoroethyl]amino]azetidine-1-carboximidamide |
| SMILES | [H]/N=C(\N)N1CC(NC(c2ccc(CC)cc2)C(F)(F)F)C1 |
| InChI | InChI=1S/C14H19F3N4/c1-2-9-3-5-10(6-4-9)12(14(15,16)17)20-11-7-21(8-11)13(18)19/h3-6,11-12,20H,2,7-8H2,1H3,(H3,18,19) |
| InChIKey | XANCZNAHRWSESN-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 65.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|