C14H23N7O2 — CID 118527440
2-[3-[[2-hydroxy-3-(6-methyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)propyl]amino]propyl]guanidine (PubChem CID 118527440) has the molecular formula C14H23N7O2 and a molecular weight of 321.39 g/mol. Its IUPAC name is 2-[3-[[2-hydroxy-3-(6-methyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)propyl]amino]propyl]guanidine.
| Compound Name | 2-[3-[[2-hydroxy-3-(6-methyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)propyl]amino]propyl]guanidine |
|---|---|
| PubChem CID | 118527440 |
| Molecular Formula | C14H23N7O2 |
| Molecular Weight | 321.39 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 2-[3-[[2-hydroxy-3-(6-methyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)propyl]amino]propyl]guanidine |
| SMILES | Cc1cc2cn(CC(O)CNCCCN=C(N)N)c(=O)nc2[nH]1 |
| InChI | InChI=1S/C14H23N7O2/c1-9-5-10-7-21(14(23)20-12(10)19-9)8-11(22)6-17-3-2-4-18-13(15)16/h5,7,11,17,22H,2-4,6,8H2,1H3,(H4,15,16,18)(H,19,20,23) |
| InChIKey | RTLHPFHNGORKCW-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 147.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.39 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|