C13H21N7O2 — CID 118527464
2-[2-[[2-hydroxy-3-(6-methyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)propyl]amino]ethyl]guanidine (PubChem CID 118527464) has the molecular formula C13H21N7O2 and a molecular weight of 307.36 g/mol. Its IUPAC name is 2-[2-[[2-hydroxy-3-(6-methyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)propyl]amino]ethyl]guanidine.
| Compound Name | 2-[2-[[2-hydroxy-3-(6-methyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)propyl]amino]ethyl]guanidine |
|---|---|
| PubChem CID | 118527464 |
| Molecular Formula | C13H21N7O2 |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 2-[2-[[2-hydroxy-3-(6-methyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)propyl]amino]ethyl]guanidine |
| SMILES | Cc1cc2cn(CC(O)CNCCN=C(N)N)c(=O)nc2[nH]1 |
| InChI | InChI=1S/C13H21N7O2/c1-8-4-9-6-20(13(22)19-11(9)18-8)7-10(21)5-16-2-3-17-12(14)15/h4,6,10,16,21H,2-3,5,7H2,1H3,(H4,14,15,17)(H,18,19,22) |
| InChIKey | KVSIWYCXEBDDKA-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 147.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|