About 3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-amine
3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-amine (PubChem CID 118528088) has the molecular formula C9H10F3N3
and a molecular weight of 217.19 g/mol. Its IUPAC name is 3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-amine.
Molecular Properties
| Compound Name | 3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-amine |
| PubChem CID | 118528088 |
| Molecular Formula | C9H10F3N3 |
| Molecular Weight | 217.19 g/mol |
| Exact Mass | 217.08 |
| IUPAC Name | 3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-amine |
| SMILES | NN1CCc2ncc(C(F)(F)F)cc2C1 |
| InChI | InChI=1S/C9H10F3N3/c10-9(11,12)7-3-6-5-15(13)2-1-8(6)14-4-7/h3-4H,1-2,5,13H2 |
| InChIKey | DYHWXVCFPWNAFI-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.19 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-amine?
The IUPAC name of 3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-amine (CID 118528088) is 3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-amine.
What is the SMILES notation for 3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-amine?
The canonical SMILES for 3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-amine is NN1CCc2ncc(C(F)(F)F)cc2C1.
What is the InChIKey of 3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-amine?
The InChIKey is DYHWXVCFPWNAFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10F3N3/c10-9(11,12)7-3-6-5-15(13)2-1-8(6)14-4-7/h3-4H,1-2,5,13H2.
What are the key properties of 3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-amine?
3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-amine has a molecular weight of 217.19 g/mol, XLogP of 1.33, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-amine is sourced from PubChem (CID 118528088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).