C21H38N4O — CID 118528256
N-[(Z)-12-(1H-1,2,4-triazol-5-yl)dodec-5-enyl]heptanamide (PubChem CID 118528256) has the molecular formula C21H38N4O and a molecular weight of 362.56 g/mol. Its IUPAC name is N-[(Z)-12-(1H-1,2,4-triazol-5-yl)dodec-5-enyl]heptanamide.
| Compound Name | N-[(Z)-12-(1H-1,2,4-triazol-5-yl)dodec-5-enyl]heptanamide |
|---|---|
| PubChem CID | 118528256 |
| Molecular Formula | C21H38N4O |
| Molecular Weight | 362.56 g/mol |
| Exact Mass | 362.30 |
| IUPAC Name | N-[(Z)-12-(1H-1,2,4-triazol-5-yl)dodec-5-enyl]heptanamide |
| SMILES | CCCCCCC(=O)NCCCC/C=C\CCCCCCc1ncn[nH]1 |
| InChI | InChI=1S/C21H38N4O/c1-2-3-4-14-17-21(26)22-18-15-12-10-8-6-5-7-9-11-13-16-20-23-19-24-25-20/h6,8,19H,2-5,7,9-18H2,1H3,(H,22,26)(H,23,24,25)/b8-6- |
| InChIKey | WIVDDESERADGMT-VURMDHGXSA-N |
| XLogP | 5.11 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.56 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|