C43H28N6O — CID 118528337
10-[4-[4-(4,6-diphenylpyrimidin-2-yl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]phenoxazine (PubChem CID 118528337) has the molecular formula C43H28N6O and a molecular weight of 644.74 g/mol. Its IUPAC name is 10-[4-[4-(4,6-diphenylpyrimidin-2-yl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]phenoxazine.
| Compound Name | 10-[4-[4-(4,6-diphenylpyrimidin-2-yl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]phenoxazine |
|---|---|
| PubChem CID | 118528337 |
| Molecular Formula | C43H28N6O |
| Molecular Weight | 644.74 g/mol |
| Exact Mass | 644.23 |
| IUPAC Name | 10-[4-[4-(4,6-diphenylpyrimidin-2-yl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]phenoxazine |
| SMILES | c1ccc(-c2cc(-c3ccccc3)nc(-c3nc(-c4ccccc4)nc(-c4ccc(N5c6ccccc6Oc6ccccc65)cc4)n3)n2)cc1 |
| InChI | InChI=1S/C43H28N6O/c1-4-14-29(15-5-1)34-28-35(30-16-6-2-7-17-30)45-42(44-34)43-47-40(31-18-8-3-9-19-31)46-41(48-43)32-24-26-33(27-25-32)49-36-20-10-12-22-38(36)50-39-23-13-11-21-37(39)49/h1-28H |
| InChIKey | GVBSDNVVZCCQLF-UHFFFAOYSA-N |
| XLogP | 10.57 |
| TPSA | 76.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.74 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |