C25H40O3 — CID 118528817
(4R,5R,6R)-4-hydroxy-3-methoxy-2,6-dimethyl-5-[(2E,6E,9E)-3,7,11,11-tetramethyldodeca-2,6,9-trienyl]cyclohex-2-en-1-one (PubChem CID 118528817) has the molecular formula C25H40O3 and a molecular weight of 388.59 g/mol. Its IUPAC name is (4R,5R,6R)-4-hydroxy-3-methoxy-2,6-dimethyl-5-[(2E,6E,9E)-3,7,11,11-tetramethyldodeca-2,6,9-trienyl]cyclohex-2-en-1-one.
| Compound Name | (4R,5R,6R)-4-hydroxy-3-methoxy-2,6-dimethyl-5-[(2E,6E,9E)-3,7,11,11-tetramethyldodeca-2,6,9-trienyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 118528817 |
| Molecular Formula | C25H40O3 |
| Molecular Weight | 388.59 g/mol |
| Exact Mass | 388.30 |
| IUPAC Name | (4R,5R,6R)-4-hydroxy-3-methoxy-2,6-dimethyl-5-[(2E,6E,9E)-3,7,11,11-tetramethyldodeca-2,6,9-trienyl]cyclohex-2-en-1-one |
| SMILES | COC1=C(C)C(=O)[C@H](C)[C@@H](C/C=C(\C)CC/C=C(\C)C/C=C/C(C)(C)C)[C@H]1O |
| InChI | InChI=1S/C25H40O3/c1-17(13-10-16-25(5,6)7)11-9-12-18(2)14-15-21-19(3)22(26)20(4)24(28-8)23(21)27/h10-11,14,16,19,21,23,27H,9,12-13,15H2,1-8H3/b16-10+,17-11+,18-14+/t19-,21-,23-/m1/s1 |
| InChIKey | TVOBXQUAIBEODQ-KGWFFTNKSA-N |
| XLogP | 6.16 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.59 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|