C27H40O5 — CID 118528819
[(1R,5R,6R)-6-[(2E,6E)-3,7-dimethyl-8-(4-methyl-5-methylideneoxolan-2-yl)octa-2,6-dienyl]-2-methoxy-3,5-dimethyl-4-oxocyclohex-2-en-1-yl] acetate (PubChem CID 118528819) has the molecular formula C27H40O5 and a molecular weight of 444.61 g/mol. Its IUPAC name is [(1R,5R,6R)-6-[(2E,6E)-3,7-dimethyl-8-(4-methyl-5-methylideneoxolan-2-yl)octa-2,6-dienyl]-2-methoxy-3,5-dimethyl-4-oxocyclohex-2-en-1-yl] acetate.
| Compound Name | [(1R,5R,6R)-6-[(2E,6E)-3,7-dimethyl-8-(4-methyl-5-methylideneoxolan-2-yl)octa-2,6-dienyl]-2-methoxy-3,5-dimethyl-4-oxocyclohex-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 118528819 |
| Molecular Formula | C27H40O5 |
| Molecular Weight | 444.61 g/mol |
| Exact Mass | 444.29 |
| IUPAC Name | [(1R,5R,6R)-6-[(2E,6E)-3,7-dimethyl-8-(4-methyl-5-methylideneoxolan-2-yl)octa-2,6-dienyl]-2-methoxy-3,5-dimethyl-4-oxocyclohex-2-en-1-yl] acetate |
| SMILES | C=C1OC(C/C(C)=C/CC/C(C)=C/C[C@@H]2[C@@H](C)C(=O)C(C)=C(OC)[C@@H]2OC(C)=O)CC1C |
| InChI | InChI=1S/C27H40O5/c1-16(10-9-11-17(2)14-23-15-18(3)21(6)31-23)12-13-24-19(4)25(29)20(5)26(30-8)27(24)32-22(7)28/h11-12,18-19,23-24,27H,6,9-10,13-15H2,1-5,7-8H3/b16-12+,17-11+/t18?,19-,23?,24-,27-/m1/s1 |
| InChIKey | CRWIOZXHZNGNHT-BMVQLZGASA-N |
| XLogP | 6.07 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.61 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|