C66H44N2 — CID 118529287
5-phenyl-1,3-bis[4-[3-(3-phenylphenyl)phenyl]phenyl]benzo[f]quinazoline (PubChem CID 118529287) has the molecular formula C66H44N2 and a molecular weight of 865.09 g/mol. Its IUPAC name is 5-phenyl-1,3-bis[4-[3-(3-phenylphenyl)phenyl]phenyl]benzo[f]quinazoline.
| Compound Name | 5-phenyl-1,3-bis[4-[3-(3-phenylphenyl)phenyl]phenyl]benzo[f]quinazoline |
|---|---|
| PubChem CID | 118529287 |
| Molecular Formula | C66H44N2 |
| Molecular Weight | 865.09 g/mol |
| Exact Mass | 864.35 |
| IUPAC Name | 5-phenyl-1,3-bis[4-[3-(3-phenylphenyl)phenyl]phenyl]benzo[f]quinazoline |
| SMILES | c1ccc(-c2cccc(-c3cccc(-c4ccc(-c5nc(-c6ccc(-c7cccc(-c8cccc(-c9ccccc9)c8)c7)cc6)c6c(n5)c(-c5ccccc5)cc5ccccc56)cc4)c3)c2)cc1 |
| InChI | InChI=1S/C66H44N2/c1-4-16-45(17-5-1)52-23-12-27-56(40-52)58-29-14-25-54(42-58)47-32-36-50(37-33-47)64-63-61-31-11-10-22-60(61)44-62(49-20-8-3-9-21-49)65(63)68-66(67-64)51-38-34-48(35-39-51)55-26-15-30-59(43-55)57-28-13-24-53(41-57)46-18-6-2-7-19-46/h1-44H |
| InChIKey | MGBWZBRKQKOYNN-UHFFFAOYSA-N |
| XLogP | 17.79 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 865.09 |
| LogP ≤ 5 | 17.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|